C15H29N — CID 142152704
ethane;1-[(3E,5Z)-3-methylhepta-3,5-dienyl]piperidine (PubChem CID 142152704) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is ethane;1-[(3E,5Z)-3-methylhepta-3,5-dienyl]piperidine.
| Compound Name | ethane;1-[(3E,5Z)-3-methylhepta-3,5-dienyl]piperidine |
|---|---|
| PubChem CID | 142152704 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | ethane;1-[(3E,5Z)-3-methylhepta-3,5-dienyl]piperidine |
| SMILES | C/C=C\C=C(/C)CCN1CCCCC1.CC |
| InChI | InChI=1S/C13H23N.C2H6/c1-3-4-8-13(2)9-12-14-10-6-5-7-11-14;1-2/h3-4,8H,5-7,9-12H2,1-2H3;1-2H3/b4-3-,13-8+; |
| InChIKey | BDVQRAMWWNNHPQ-CQPQAKJBSA-N |
| XLogP | 4.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|