C9H13NO — CID 142154447
7-methyl-3,5,8,8a-tetrahydro-1H-indolizin-2-one (PubChem CID 142154447) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 7-methyl-3,5,8,8a-tetrahydro-1H-indolizin-2-one.
| Compound Name | 7-methyl-3,5,8,8a-tetrahydro-1H-indolizin-2-one |
|---|---|
| PubChem CID | 142154447 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 7-methyl-3,5,8,8a-tetrahydro-1H-indolizin-2-one |
| SMILES | CC1=CCN2CC(=O)CC2C1 |
| InChI | InChI=1S/C9H13NO/c1-7-2-3-10-6-9(11)5-8(10)4-7/h2,8H,3-6H2,1H3 |
| InChIKey | RGTIQKIYJAPLTK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|