C26H30Cl2N4O6 — CID 142155693
(2S)-2-[[2,6-dichloro-4-[[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]methyl]benzoyl]amino]-4-[[[(2S,4S)-4-ethenylpyrrolidin-2-yl]-hydroxymethyl]amino]butanoic acid (PubChem CID 142155693) has the molecular formula C26H30Cl2N4O6 and a molecular weight of 565.45 g/mol. Its IUPAC name is (2S)-2-[[2,6-dichloro-4-[[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]methyl]benzoyl]amino]-4-[[[(2S,4S)-4-ethenylpyrrolidin-2-yl]-hydroxymethyl]amino]butanoic acid.
| Compound Name | (2S)-2-[[2,6-dichloro-4-[[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]methyl]benzoyl]amino]-4-[[[(2S,4S)-4-ethenylpyrrolidin-2-yl]-hydroxymethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 142155693 |
| Molecular Formula | C26H30Cl2N4O6 |
| Molecular Weight | 565.45 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | (2S)-2-[[2,6-dichloro-4-[[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]methyl]benzoyl]amino]-4-[[[(2S,4S)-4-ethenylpyrrolidin-2-yl]-hydroxymethyl]amino]butanoic acid |
| SMILES | C=C[C@H]1CN[C@H](C(O)NCC[C@H](NC(=O)c2c(Cl)cc(CNC(=O)/C=C/c3ccco3)cc2Cl)C(=O)O)C1 |
| InChI | InChI=1S/C26H30Cl2N4O6/c1-2-15-12-21(30-13-15)24(34)29-8-7-20(26(36)37)32-25(35)23-18(27)10-16(11-19(23)28)14-31-22(33)6-5-17-4-3-9-38-17/h2-6,9-11,15,20-21,24,29-30,34H,1,7-8,12-14H2,(H,31,33)(H,32,35)(H,36,37)/b6-5+/t15-,20+,21+,24?/m1/s1 |
| InChIKey | WRZPGACFAUDLON-RXQIFEEDSA-N |
| XLogP | 2.56 |
| TPSA | 152.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|