C23H22Cl2N4O7S — CID 143139752
(2S)-2-[[2,6-dichloro-4-[[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]methyl]benzoyl]amino]-4-[[(4R)-2-oxo-1,3-thiazolidine-4-carbonyl]amino]butanoic acid (PubChem CID 143139752) has the molecular formula C23H22Cl2N4O7S and a molecular weight of 569.42 g/mol. Its IUPAC name is (2S)-2-[[2,6-dichloro-4-[[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]methyl]benzoyl]amino]-4-[[(4R)-2-oxo-1,3-thiazolidine-4-carbonyl]amino]butanoic acid.
| Compound Name | (2S)-2-[[2,6-dichloro-4-[[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]methyl]benzoyl]amino]-4-[[(4R)-2-oxo-1,3-thiazolidine-4-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 143139752 |
| Molecular Formula | C23H22Cl2N4O7S |
| Molecular Weight | 569.42 g/mol |
| Exact Mass | 568.06 |
| IUPAC Name | (2S)-2-[[2,6-dichloro-4-[[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]methyl]benzoyl]amino]-4-[[(4R)-2-oxo-1,3-thiazolidine-4-carbonyl]amino]butanoic acid |
| SMILES | O=C(/C=C/c1ccco1)NCc1cc(Cl)c(C(=O)N[C@@H](CCNC(=O)[C@@H]2CSC(=O)N2)C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C23H22Cl2N4O7S/c24-14-8-12(10-27-18(30)4-3-13-2-1-7-36-13)9-15(25)19(14)21(32)28-16(22(33)34)5-6-26-20(31)17-11-37-23(35)29-17/h1-4,7-9,16-17H,5-6,10-11H2,(H,26,31)(H,27,30)(H,28,32)(H,29,35)(H,33,34)/b4-3+/t16-,17-/m0/s1 |
| InChIKey | ZCXWPMLZLZCBQB-RYTMFUSVSA-N |
| XLogP | 2.43 |
| TPSA | 166.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|