C15H17N3O4 — CID 142156229
(4Z)-4-(1-aminobut-3-en-2-ylidene)-1-(2,6-dioxopiperidin-3-yl)-3-methylidene-5-oxopyrrolidine-2-carbaldehyde (PubChem CID 142156229) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is (4Z)-4-(1-aminobut-3-en-2-ylidene)-1-(2,6-dioxopiperidin-3-yl)-3-methylidene-5-oxopyrrolidine-2-carbaldehyde.
| Compound Name | (4Z)-4-(1-aminobut-3-en-2-ylidene)-1-(2,6-dioxopiperidin-3-yl)-3-methylidene-5-oxopyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 142156229 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | (4Z)-4-(1-aminobut-3-en-2-ylidene)-1-(2,6-dioxopiperidin-3-yl)-3-methylidene-5-oxopyrrolidine-2-carbaldehyde |
| SMILES | C=C/C(CN)=C1\C(=C)C(C=O)N(C2CCC(=O)NC2=O)C1=O |
| InChI | InChI=1S/C15H17N3O4/c1-3-9(6-16)13-8(2)11(7-19)18(15(13)22)10-4-5-12(20)17-14(10)21/h3,7,10-11H,1-2,4-6,16H2,(H,17,20,21)/b13-9- |
| InChIKey | ATFANYIEQCFEMW-LCYFTJDESA-N |
| XLogP | -0.80 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|