C18H27N — CID 142156500
ethane;4,4,10,10-tetramethyl-3-azabicyclo[6.5.0]trideca-1(13),2,5,6,8-pentaene (PubChem CID 142156500) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is ethane;4,4,10,10-tetramethyl-3-azabicyclo[6.5.0]trideca-1(13),2,5,6,8-pentaene.
| Compound Name | ethane;4,4,10,10-tetramethyl-3-azabicyclo[6.5.0]trideca-1(13),2,5,6,8-pentaene |
|---|---|
| PubChem CID | 142156500 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | ethane;4,4,10,10-tetramethyl-3-azabicyclo[6.5.0]trideca-1(13),2,5,6,8-pentaene |
| SMILES | CC.CC1(C)C=C2C=C=CC(C)(C)/N=C\C2=CCC1 |
| InChI | InChI=1S/C16H21N.C2H6/c1-15(2)9-5-8-14-12-17-16(3,4)10-6-7-13(14)11-15;1-2/h7-8,10-12H,5,9H2,1-4H3;1-2H3/b17-12-; |
| InChIKey | CWBIPQCIJJKZCB-HBPAQXCTSA-N |
| XLogP | 5.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |