C16H19N — CID 145149108
(2Z,4Z,6Z)-11-methyl-11-propan-2-yl-10-azabicyclo[6.5.0]trideca-1(8),2,4,6,9,12-hexaene (PubChem CID 145149108) has the molecular formula C16H19N and a molecular weight of 225.34 g/mol. Its IUPAC name is (2Z,4Z,6Z)-11-methyl-11-propan-2-yl-10-azabicyclo[6.5.0]trideca-1(8),2,4,6,9,12-hexaene.
| Compound Name | (2Z,4Z,6Z)-11-methyl-11-propan-2-yl-10-azabicyclo[6.5.0]trideca-1(8),2,4,6,9,12-hexaene |
|---|---|
| PubChem CID | 145149108 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | (2Z,4Z,6Z)-11-methyl-11-propan-2-yl-10-azabicyclo[6.5.0]trideca-1(8),2,4,6,9,12-hexaene |
| SMILES | CC(C)C1(C)C=CC2=C(C=N1)/C=C\C=C/C=C\2 |
| InChI | InChI=1S/C16H19N/c1-13(2)16(3)11-10-14-8-6-4-5-7-9-15(14)12-17-16/h4-13H,1-3H3/b5-4-,6-4-,7-5-,8-6-,9-7-,14-8-,15-9- |
| InChIKey | KEQLXXFBTSAEOF-FEDNHLLISA-N |
| XLogP | 4.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |