C13H21N — CID 90979377
2-ethyl-2,4,7,7-tetramethylazocine (PubChem CID 90979377) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 2-ethyl-2,4,7,7-tetramethylazocine.
| Compound Name | 2-ethyl-2,4,7,7-tetramethylazocine |
|---|---|
| PubChem CID | 90979377 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 2-ethyl-2,4,7,7-tetramethylazocine |
| SMILES | CCC1(C)C=C(C)C=CC(C)(C)/C=N\1 |
| InChI | InChI=1S/C13H21N/c1-6-13(5)9-11(2)7-8-12(3,4)10-14-13/h7-10H,6H2,1-5H3/b8-7?,11-9?,14-10- |
| InChIKey | DVOGVDABGIHVBE-MQCSIVHLSA-N |
| XLogP | 3.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |