C15H23N — CID 123287059
N-but-2-enyl-4,5-dimethylnona-4,6,7-trien-1-imine (PubChem CID 123287059) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is N-but-2-enyl-4,5-dimethylnona-4,6,7-trien-1-imine.
| Compound Name | N-but-2-enyl-4,5-dimethylnona-4,6,7-trien-1-imine |
|---|---|
| PubChem CID | 123287059 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | N-but-2-enyl-4,5-dimethylnona-4,6,7-trien-1-imine |
| SMILES | CC=C=CC(C)=C(C)CC/C=N/CC=CC |
| InChI | InChI=1S/C15H23N/c1-5-7-10-14(3)15(4)11-9-13-16-12-8-6-2/h5-6,8,10,13H,9,11-12H2,1-4H3/b8-6?,15-14?,16-13+ |
| InChIKey | BWGIYLPKRHSLGT-MLVNBEDHSA-N |
| XLogP | 4.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|