C11H19N — CID 142913207
N-[(2E,6Z)-2-methylocta-2,6-dienyl]ethanimine (PubChem CID 142913207) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is N-[(2E,6Z)-2-methylocta-2,6-dienyl]ethanimine.
| Compound Name | N-[(2E,6Z)-2-methylocta-2,6-dienyl]ethanimine |
|---|---|
| PubChem CID | 142913207 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | N-[(2E,6Z)-2-methylocta-2,6-dienyl]ethanimine |
| SMILES | C/C=C\CC/C=C(\C)C/N=C/C |
| InChI | InChI=1S/C11H19N/c1-4-6-7-8-9-11(3)10-12-5-2/h4-6,9H,7-8,10H2,1-3H3/b6-4-,11-9+,12-5+ |
| InChIKey | RSULLEYICRFOKL-CQYGKZTESA-N |
| XLogP | 3.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|