C20H29N — CID 142304888
4-methyl-6-[(3E,5Z,7Z)-7-methylnona-3,5,7-trien-4-yl]-4-propylazepine (PubChem CID 142304888) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is 4-methyl-6-[(3E,5Z,7Z)-7-methylnona-3,5,7-trien-4-yl]-4-propylazepine.
| Compound Name | 4-methyl-6-[(3E,5Z,7Z)-7-methylnona-3,5,7-trien-4-yl]-4-propylazepine |
|---|---|
| PubChem CID | 142304888 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 4-methyl-6-[(3E,5Z,7Z)-7-methylnona-3,5,7-trien-4-yl]-4-propylazepine |
| SMILES | C/C=C(C)\C=C/C(=C\CC)C1=CC(C)(CCC)C=CN=C1 |
| InChI | InChI=1S/C20H29N/c1-6-9-18(11-10-17(4)8-3)19-15-20(5,12-7-2)13-14-21-16-19/h8-11,13-16H,6-7,12H2,1-5H3/b11-10-,17-8-,18-9+ |
| InChIKey | JKKLONIMAMJOAU-ZJPPDFJRSA-N |
| XLogP | 6.18 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|