C16H21N — CID 142156501
4,4,10,10-tetramethyl-3-azabicyclo[6.5.0]trideca-1(13),2,5,6,8-pentaene (PubChem CID 142156501) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 4,4,10,10-tetramethyl-3-azabicyclo[6.5.0]trideca-1(13),2,5,6,8-pentaene.
| Compound Name | 4,4,10,10-tetramethyl-3-azabicyclo[6.5.0]trideca-1(13),2,5,6,8-pentaene |
|---|---|
| PubChem CID | 142156501 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 4,4,10,10-tetramethyl-3-azabicyclo[6.5.0]trideca-1(13),2,5,6,8-pentaene |
| SMILES | CC1(C)C=C2C=C=CC(C)(C)/N=C\C2=CCC1 |
| InChI | InChI=1S/C16H21N/c1-15(2)9-5-8-14-12-17-16(3,4)10-6-7-13(14)11-15/h7-8,10-12H,5,9H2,1-4H3/b17-12- |
| InChIKey | KPVQGHHSKXCANI-ATVHPVEESA-N |
| XLogP | 4.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |