C15H13F2NO3S — CID 142161132
[4-(2,6-difluorophenyl)-4-oxo-1-thiophen-2-ylbutyl]carbamic acid (PubChem CID 142161132) has the molecular formula C15H13F2NO3S and a molecular weight of 325.34 g/mol. Its IUPAC name is [4-(2,6-difluorophenyl)-4-oxo-1-thiophen-2-ylbutyl]carbamic acid.
| Compound Name | [4-(2,6-difluorophenyl)-4-oxo-1-thiophen-2-ylbutyl]carbamic acid |
|---|---|
| PubChem CID | 142161132 |
| Molecular Formula | C15H13F2NO3S |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | [4-(2,6-difluorophenyl)-4-oxo-1-thiophen-2-ylbutyl]carbamic acid |
| SMILES | O=C(O)NC(CCC(=O)c1c(F)cccc1F)c1cccs1 |
| InChI | InChI=1S/C15H13F2NO3S/c16-9-3-1-4-10(17)14(9)12(19)7-6-11(18-15(20)21)13-5-2-8-22-13/h1-5,8,11,18H,6-7H2,(H,20,21) |
| InChIKey | WTDZBHPFDGTLGI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |