C13H10FNO4S — CID 107013766
2-[(2-fluoro-6-hydroxybenzoyl)amino]-2-thiophen-2-ylacetic acid (PubChem CID 107013766) has the molecular formula C13H10FNO4S and a molecular weight of 295.29 g/mol. Its IUPAC name is 2-[(2-fluoro-6-hydroxybenzoyl)amino]-2-thiophen-2-ylacetic acid.
| Compound Name | 2-[(2-fluoro-6-hydroxybenzoyl)amino]-2-thiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 107013766 |
| Molecular Formula | C13H10FNO4S |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 2-[(2-fluoro-6-hydroxybenzoyl)amino]-2-thiophen-2-ylacetic acid |
| SMILES | O=C(NC(C(=O)O)c1cccs1)c1c(O)cccc1F |
| InChI | InChI=1S/C13H10FNO4S/c14-7-3-1-4-8(16)10(7)12(17)15-11(13(18)19)9-5-2-6-20-9/h1-6,11,16H,(H,15,17)(H,18,19) |
| InChIKey | GPFYNNWFTHMVMQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |