C19H34O6S — CID 142166664
2-(2-methylprop-2-enoyloxy)ethyl (Z)-9-(ethoxy-ethyl-hydroxy-λ4-sulfanyl)non-6-enoate (PubChem CID 142166664) has the molecular formula C19H34O6S and a molecular weight of 390.54 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl (Z)-9-(ethoxy-ethyl-hydroxy-λ4-sulfanyl)non-6-enoate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl (Z)-9-(ethoxy-ethyl-hydroxy-λ4-sulfanyl)non-6-enoate |
|---|---|
| PubChem CID | 142166664 |
| Molecular Formula | C19H34O6S |
| Molecular Weight | 390.54 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl (Z)-9-(ethoxy-ethyl-hydroxy-λ4-sulfanyl)non-6-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CCCC/C=C\CCS(O)(CC)OCC |
| InChI | InChI=1S/C19H34O6S/c1-5-25-26(22,6-2)16-12-10-8-7-9-11-13-18(20)23-14-15-24-19(21)17(3)4/h8,10,22H,3,5-7,9,11-16H2,1-2,4H3/b10-8- |
| InChIKey | YAIBVAWYVRTEKO-NTMALXAHSA-N |
| XLogP | 4.40 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|