C20H27NO5S — CID 142167214
ethane;N-(2-hydroxyethyl)-2-[[4-(3-methoxyphenyl)phenyl]methylsulfonyl]acetamide (PubChem CID 142167214) has the molecular formula C20H27NO5S and a molecular weight of 393.51 g/mol. Its IUPAC name is ethane;N-(2-hydroxyethyl)-2-[[4-(3-methoxyphenyl)phenyl]methylsulfonyl]acetamide.
| Compound Name | ethane;N-(2-hydroxyethyl)-2-[[4-(3-methoxyphenyl)phenyl]methylsulfonyl]acetamide |
|---|---|
| PubChem CID | 142167214 |
| Molecular Formula | C20H27NO5S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | ethane;N-(2-hydroxyethyl)-2-[[4-(3-methoxyphenyl)phenyl]methylsulfonyl]acetamide |
| SMILES | CC.COc1cccc(-c2ccc(CS(=O)(=O)CC(=O)NCCO)cc2)c1 |
| InChI | InChI=1S/C18H21NO5S.C2H6/c1-24-17-4-2-3-16(11-17)15-7-5-14(6-8-15)12-25(22,23)13-18(21)19-9-10-20;1-2/h2-8,11,20H,9-10,12-13H2,1H3,(H,19,21);1-2H3 |
| InChIKey | ZTNIAQCASNARNF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |