C38H58N4O4 — CID 142167953
tert-butyl carbamate;3-[4-[1,5-diethyl-2-[2-(4-phenylmethoxyphenyl)ethyl]imidazol-4-yl]but-1-en-2-yloxy]-N,N-diethylpropan-1-amine (PubChem CID 142167953) has the molecular formula C38H58N4O4 and a molecular weight of 634.91 g/mol. Its IUPAC name is tert-butyl carbamate;3-[4-[1,5-diethyl-2-[2-(4-phenylmethoxyphenyl)ethyl]imidazol-4-yl]but-1-en-2-yloxy]-N,N-diethylpropan-1-amine.
| Compound Name | tert-butyl carbamate;3-[4-[1,5-diethyl-2-[2-(4-phenylmethoxyphenyl)ethyl]imidazol-4-yl]but-1-en-2-yloxy]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 142167953 |
| Molecular Formula | C38H58N4O4 |
| Molecular Weight | 634.91 g/mol |
| Exact Mass | 634.45 |
| IUPAC Name | tert-butyl carbamate;3-[4-[1,5-diethyl-2-[2-(4-phenylmethoxyphenyl)ethyl]imidazol-4-yl]but-1-en-2-yloxy]-N,N-diethylpropan-1-amine |
| SMILES | C=C(CCc1nc(CCc2ccc(OCc3ccccc3)cc2)n(CC)c1CC)OCCCN(CC)CC.CC(C)(C)OC(N)=O |
| InChI | InChI=1S/C33H47N3O2.C5H11NO2/c1-6-32-31(22-16-27(5)37-25-13-24-35(7-2)8-3)34-33(36(32)9-4)23-19-28-17-20-30(21-18-28)38-26-29-14-11-10-12-15-29;1-5(2,3)8-4(6)7/h10-12,14-15,17-18,20-21H,5-9,13,16,19,22-26H2,1-4H3;1-3H3,(H2,6,7) |
| InChIKey | XENUSOLNCPVRBB-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.91 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|