C20H35N — CID 142170584
N-[(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)methyl]-N,2,3,3-tetramethylhexan-1-amine (PubChem CID 142170584) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is N-[(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)methyl]-N,2,3,3-tetramethylhexan-1-amine.
| Compound Name | N-[(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)methyl]-N,2,3,3-tetramethylhexan-1-amine |
|---|---|
| PubChem CID | 142170584 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | N-[(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)methyl]-N,2,3,3-tetramethylhexan-1-amine |
| SMILES | CCCC(C)(C)C(C)CN(C)CC1=CC=CC(C)(C)C=C1 |
| InChI | InChI=1S/C20H35N/c1-8-12-20(5,6)17(2)15-21(7)16-18-10-9-13-19(3,4)14-11-18/h9-11,13-14,17H,8,12,15-16H2,1-7H3 |
| InChIKey | SBKSVEPWNXAYRG-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |