C17H19NO4 — CID 142171646
5,8-dihydroxy-2-methyl-6-[(2-methylpyrrolidin-1-yl)methyl]naphthalene-1,4-dione (PubChem CID 142171646) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is 5,8-dihydroxy-2-methyl-6-[(2-methylpyrrolidin-1-yl)methyl]naphthalene-1,4-dione.
| Compound Name | 5,8-dihydroxy-2-methyl-6-[(2-methylpyrrolidin-1-yl)methyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 142171646 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 5,8-dihydroxy-2-methyl-6-[(2-methylpyrrolidin-1-yl)methyl]naphthalene-1,4-dione |
| SMILES | CC1=CC(=O)c2c(O)c(CN3CCCC3C)cc(O)c2C1=O |
| InChI | InChI=1S/C17H19NO4/c1-9-6-12(19)15-14(16(9)21)13(20)7-11(17(15)22)8-18-5-3-4-10(18)2/h6-7,10,20,22H,3-5,8H2,1-2H3 |
| InChIKey | FNCNNYMAFVSWRM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|