ethane;3-ethenyl-N-ethyl-5-methylaniline;molecular hydrogen

C13H23N — CID 142172173

IUPACethane;3-ethenyl-N-ethyl-5-methylaniline;molecular hydrogen
SMILESC=Cc1cc(C)cc(NCC)c1.CC.[H][H]
InChIInChI=1S/C11H15N.C2H6.H2/c1-4-10-6-9(3)7-11(8-10)12-5-2;1-2;/h4,6-8,12H,1,5H2,2-3H3;1-2H3;1H
InChIKeyDAQXFPFXOZQFOU-UHFFFAOYSA-N
MW193.33 g/mol
LogP4.34
Rot. Bonds3

About ethane;3-ethenyl-N-ethyl-5-methylaniline;molecular hydrogen

ethane;3-ethenyl-N-ethyl-5-methylaniline;molecular hydrogen (PubChem CID 142172173) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is ethane;3-ethenyl-N-ethyl-5-methylaniline;molecular hydrogen.

Molecular Properties

Compound Nameethane;3-ethenyl-N-ethyl-5-methylaniline;molecular hydrogen
PubChem CID142172173
Molecular FormulaC13H23N
Molecular Weight193.33 g/mol
Exact Mass193.18
IUPAC Nameethane;3-ethenyl-N-ethyl-5-methylaniline;molecular hydrogen
SMILESC=Cc1cc(C)cc(NCC)c1.CC.[H][H]
InChIInChI=1S/C11H15N.C2H6.H2/c1-4-10-6-9(3)7-11(8-10)12-5-2;1-2;/h4,6-8,12H,1,5H2,2-3H3;1-2H3;1H
InChIKeyDAQXFPFXOZQFOU-UHFFFAOYSA-N
XLogP4.34
TPSA12.03 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.33
LogP ≤ 54.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze ethane;3-ethenyl-N-ethyl-5-methylaniline;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;3-ethenyl-N-ethyl-5-methylaniline;molecular hydrogen?
The IUPAC name of ethane;3-ethenyl-N-ethyl-5-methylaniline;molecular hydrogen (CID 142172173) is ethane;3-ethenyl-N-ethyl-5-methylaniline;molecular hydrogen.
What is the SMILES notation for ethane;3-ethenyl-N-ethyl-5-methylaniline;molecular hydrogen?
The canonical SMILES for ethane;3-ethenyl-N-ethyl-5-methylaniline;molecular hydrogen is C=Cc1cc(C)cc(NCC)c1.CC.[H][H].
What is the InChIKey of ethane;3-ethenyl-N-ethyl-5-methylaniline;molecular hydrogen?
The InChIKey is DAQXFPFXOZQFOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.C2H6.H2/c1-4-10-6-9(3)7-11(8-10)12-5-2;1-2;/h4,6-8,12H,1,5H2,2-3H3;1-2H3;1H.
What are the key properties of ethane;3-ethenyl-N-ethyl-5-methylaniline;molecular hydrogen?
ethane;3-ethenyl-N-ethyl-5-methylaniline;molecular hydrogen has a molecular weight of 193.33 g/mol, XLogP of 4.34, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-ethenyl-N-ethyl-5-methylaniline;molecular hydrogen is sourced from PubChem (CID 142172173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).