C20H20FS+ — CID 142174226
[(2Z,4E,6E)-7-fluoroocta-2,4,6-trien-4-yl]-diphenylsulfanium (PubChem CID 142174226) has the molecular formula C20H20FS+ and a molecular weight of 311.45 g/mol. Its IUPAC name is [(2Z,4E,6E)-7-fluoroocta-2,4,6-trien-4-yl]-diphenylsulfanium.
| Compound Name | [(2Z,4E,6E)-7-fluoroocta-2,4,6-trien-4-yl]-diphenylsulfanium |
|---|---|
| PubChem CID | 142174226 |
| Molecular Formula | C20H20FS+ |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | [(2Z,4E,6E)-7-fluoroocta-2,4,6-trien-4-yl]-diphenylsulfanium |
| SMILES | C/C=C\C(=C/C=C(\C)F)[S+](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H20FS/c1-3-10-18(16-15-17(2)21)22(19-11-6-4-7-12-19)20-13-8-5-9-14-20/h3-16H,1-2H3/q+1/b10-3-,17-15+,18-16+ |
| InChIKey | RRFQHMBXSRGQKV-LQXBJWCASA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|