C17H17BrFN — CID 142175412
2-(4-bromo-4-methylcyclohexa-1,5-dien-1-yl)-5-(2-fluorophenyl)-3,4-dihydro-2H-pyrrole (PubChem CID 142175412) has the molecular formula C17H17BrFN and a molecular weight of 334.23 g/mol. Its IUPAC name is 2-(4-bromo-4-methylcyclohexa-1,5-dien-1-yl)-5-(2-fluorophenyl)-3,4-dihydro-2H-pyrrole.
| Compound Name | 2-(4-bromo-4-methylcyclohexa-1,5-dien-1-yl)-5-(2-fluorophenyl)-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 142175412 |
| Molecular Formula | C17H17BrFN |
| Molecular Weight | 334.23 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 2-(4-bromo-4-methylcyclohexa-1,5-dien-1-yl)-5-(2-fluorophenyl)-3,4-dihydro-2H-pyrrole |
| SMILES | CC1(Br)C=CC(C2CCC(c3ccccc3F)=N2)=CC1 |
| InChI | InChI=1S/C17H17BrFN/c1-17(18)10-8-12(9-11-17)15-6-7-16(20-15)13-4-2-3-5-14(13)19/h2-5,8-10,15H,6-7,11H2,1H3 |
| InChIKey | NYFVOANVOMYCSV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.23 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|