C11H11BrFN — CID 25214294
2-(bromomethyl)-5-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole (PubChem CID 25214294) has the molecular formula C11H11BrFN and a molecular weight of 256.12 g/mol. Its IUPAC name is 2-(bromomethyl)-5-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole.
| Compound Name | 2-(bromomethyl)-5-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 25214294 |
| Molecular Formula | C11H11BrFN |
| Molecular Weight | 256.12 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | 2-(bromomethyl)-5-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole |
| SMILES | Fc1ccc(C2=NC(CBr)CC2)cc1 |
| InChI | InChI=1S/C11H11BrFN/c12-7-10-5-6-11(14-10)8-1-3-9(13)4-2-8/h1-4,10H,5-7H2 |
| InChIKey | GVCGOKBRVGWWES-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.12 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|