C19H21ClFN — CID 142175426
5-(4-chlorophenyl)-2-[(3E,7Z)-9-fluoronona-1,3,7-trien-4-yl]-3,4-dihydro-2H-pyrrole (PubChem CID 142175426) has the molecular formula C19H21ClFN and a molecular weight of 317.84 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[(3E,7Z)-9-fluoronona-1,3,7-trien-4-yl]-3,4-dihydro-2H-pyrrole.
| Compound Name | 5-(4-chlorophenyl)-2-[(3E,7Z)-9-fluoronona-1,3,7-trien-4-yl]-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 142175426 |
| Molecular Formula | C19H21ClFN |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[(3E,7Z)-9-fluoronona-1,3,7-trien-4-yl]-3,4-dihydro-2H-pyrrole |
| SMILES | C=C/C=C(\CC/C=C\CF)C1CCC(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C19H21ClFN/c1-2-6-15(7-4-3-5-14-21)18-12-13-19(22-18)16-8-10-17(20)11-9-16/h2-3,5-6,8-11,18H,1,4,7,12-14H2/b5-3-,15-6+ |
| InChIKey | WBQGPZDSDZPAHR-QFJUEOODSA-N |
| XLogP | 5.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|