C15H25FN2 — CID 142182809
1-(4-fluorocyclohexa-1,3-dien-1-yl)-4-pentylpiperazine (PubChem CID 142182809) has the molecular formula C15H25FN2 and a molecular weight of 252.38 g/mol. Its IUPAC name is 1-(4-fluorocyclohexa-1,3-dien-1-yl)-4-pentylpiperazine.
| Compound Name | 1-(4-fluorocyclohexa-1,3-dien-1-yl)-4-pentylpiperazine |
|---|---|
| PubChem CID | 142182809 |
| Molecular Formula | C15H25FN2 |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 1-(4-fluorocyclohexa-1,3-dien-1-yl)-4-pentylpiperazine |
| SMILES | CCCCCN1CCN(C2=CC=C(F)CC2)CC1 |
| InChI | InChI=1S/C15H25FN2/c1-2-3-4-9-17-10-12-18(13-11-17)15-7-5-14(16)6-8-15/h5,7H,2-4,6,8-13H2,1H3 |
| InChIKey | ZGVGTKPGIKWGNV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|