C10H15FN2S — CID 123854731
1-(4-fluorocyclohexa-1,3-dien-1-yl)-4-sulfanylpiperazine (PubChem CID 123854731) has the molecular formula C10H15FN2S and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-(4-fluorocyclohexa-1,3-dien-1-yl)-4-sulfanylpiperazine.
| Compound Name | 1-(4-fluorocyclohexa-1,3-dien-1-yl)-4-sulfanylpiperazine |
|---|---|
| PubChem CID | 123854731 |
| Molecular Formula | C10H15FN2S |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 1-(4-fluorocyclohexa-1,3-dien-1-yl)-4-sulfanylpiperazine |
| SMILES | FC1=CC=C(N2CCN(S)CC2)CC1 |
| InChI | InChI=1S/C10H15FN2S/c11-9-1-3-10(4-2-9)12-5-7-13(14)8-6-12/h1,3,14H,2,4-8H2 |
| InChIKey | JUTSKCGWSMOOKH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|