C19H28N2O4 — CID 142184625
3-[2-(3,5-dimethoxyphenyl)ethyl]-3,9-diazabicyclo[3.3.1]nonane-2,4-dione;ethane (PubChem CID 142184625) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 3-[2-(3,5-dimethoxyphenyl)ethyl]-3,9-diazabicyclo[3.3.1]nonane-2,4-dione;ethane.
| Compound Name | 3-[2-(3,5-dimethoxyphenyl)ethyl]-3,9-diazabicyclo[3.3.1]nonane-2,4-dione;ethane |
|---|---|
| PubChem CID | 142184625 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 3-[2-(3,5-dimethoxyphenyl)ethyl]-3,9-diazabicyclo[3.3.1]nonane-2,4-dione;ethane |
| SMILES | CC.COc1cc(CCN2C(=O)C3CCCC(N3)C2=O)cc(OC)c1 |
| InChI | InChI=1S/C17H22N2O4.C2H6/c1-22-12-8-11(9-13(10-12)23-2)6-7-19-16(20)14-4-3-5-15(18-14)17(19)21;1-2/h8-10,14-15,18H,3-7H2,1-2H3;1-2H3 |
| InChIKey | STGYTIQVVQQMLC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|