C22H26N4O3S — CID 142184684
6-methoxy-17-[(6-methoxy-3-pyridinyl)amino]sulfanyl-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3(8),4,6-trien-12-one (PubChem CID 142184684) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is 6-methoxy-17-[(6-methoxy-3-pyridinyl)amino]sulfanyl-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3(8),4,6-trien-12-one.
| Compound Name | 6-methoxy-17-[(6-methoxy-3-pyridinyl)amino]sulfanyl-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3(8),4,6-trien-12-one |
|---|---|
| PubChem CID | 142184684 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 6-methoxy-17-[(6-methoxy-3-pyridinyl)amino]sulfanyl-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3(8),4,6-trien-12-one |
| SMILES | COc1ccc2c(c1)CCN1C(=O)C3CCCC(C21)N3SNc1ccc(OC)nc1 |
| InChI | InChI=1S/C22H26N4O3S/c1-28-16-7-8-17-14(12-16)10-11-25-21(17)18-4-3-5-19(22(25)27)26(18)30-24-15-6-9-20(29-2)23-13-15/h6-9,12-13,18-19,21,24H,3-5,10-11H2,1-2H3 |
| InChIKey | AFRCJUXYWNOTRH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|