C9H19N3O2 — CID 142186960
N,3-dimethyl-2-oxo-1,3-diazinane-1-carboxamide;ethane (PubChem CID 142186960) has the molecular formula C9H19N3O2 and a molecular weight of 201.27 g/mol. Its IUPAC name is N,3-dimethyl-2-oxo-1,3-diazinane-1-carboxamide;ethane.
| Compound Name | N,3-dimethyl-2-oxo-1,3-diazinane-1-carboxamide;ethane |
|---|---|
| PubChem CID | 142186960 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | N,3-dimethyl-2-oxo-1,3-diazinane-1-carboxamide;ethane |
| SMILES | CC.CNC(=O)N1CCCN(C)C1=O |
| InChI | InChI=1S/C7H13N3O2.C2H6/c1-8-6(11)10-5-3-4-9(2)7(10)12;1-2/h3-5H2,1-2H3,(H,8,11);1-2H3 |
| InChIKey | LNFZZGPRFZKFTA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |