C27H36N4O2 — CID 142188088
3-amino-4-(1H-indol-3-yl)butanoic acid;ethane;(2R)-1-(1H-indol-3-yl)pent-4-en-2-amine (PubChem CID 142188088) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is 3-amino-4-(1H-indol-3-yl)butanoic acid;ethane;(2R)-1-(1H-indol-3-yl)pent-4-en-2-amine.
| Compound Name | 3-amino-4-(1H-indol-3-yl)butanoic acid;ethane;(2R)-1-(1H-indol-3-yl)pent-4-en-2-amine |
|---|---|
| PubChem CID | 142188088 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 3-amino-4-(1H-indol-3-yl)butanoic acid;ethane;(2R)-1-(1H-indol-3-yl)pent-4-en-2-amine |
| SMILES | C=CC[C@@H](N)Cc1c[nH]c2ccccc12.CC.NC(CC(=O)O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C13H16N2.C12H14N2O2.C2H6/c1-2-5-11(14)8-10-9-15-13-7-4-3-6-12(10)13;13-9(6-12(15)16)5-8-7-14-11-4-2-1-3-10(8)11;1-2/h2-4,6-7,9,11,15H,1,5,8,14H2;1-4,7,9,14H,5-6,13H2,(H,15,16);1-2H3/t11-;;/m1../s1 |
| InChIKey | YJTDSCBMPGLHJB-NVJADKKVSA-N |
| XLogP | 5.15 |
| TPSA | 120.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|