C24H23N3O4 — CID 142191139
(2R,9R)-2-(1,3-benzodioxol-5-yl)-2,6-dimethyl-3,6,18-triazatetracyclo[9.7.0.03,9.012,17]octadeca-1(11),12,14,16-tetraene-4,7-dione (PubChem CID 142191139) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is (2R,9R)-2-(1,3-benzodioxol-5-yl)-2,6-dimethyl-3,6,18-triazatetracyclo[9.7.0.03,9.012,17]octadeca-1(11),12,14,16-tetraene-4,7-dione.
| Compound Name | (2R,9R)-2-(1,3-benzodioxol-5-yl)-2,6-dimethyl-3,6,18-triazatetracyclo[9.7.0.03,9.012,17]octadeca-1(11),12,14,16-tetraene-4,7-dione |
|---|---|
| PubChem CID | 142191139 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (2R,9R)-2-(1,3-benzodioxol-5-yl)-2,6-dimethyl-3,6,18-triazatetracyclo[9.7.0.03,9.012,17]octadeca-1(11),12,14,16-tetraene-4,7-dione |
| SMILES | CN1CC(=O)N2[C@@H](CC1=O)Cc1c([nH]c3ccccc13)[C@@]2(C)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H23N3O4/c1-24(14-7-8-19-20(9-14)31-13-30-19)23-17(16-5-3-4-6-18(16)25-23)10-15-11-21(28)26(2)12-22(29)27(15)24/h3-9,15,25H,10-13H2,1-2H3/t15-,24-/m1/s1 |
| InChIKey | TXKPAVDNWIZRRW-OYLFLEFRSA-N |
| XLogP | 2.78 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |