C22H21N3O4 — CID 23590409
3-[[2-(1,3-benzodioxol-5-ylmethyl)-1H-indol-3-yl]methyl]-1-methylpiperazine-2,5-dione (PubChem CID 23590409) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is 3-[[2-(1,3-benzodioxol-5-ylmethyl)-1H-indol-3-yl]methyl]-1-methylpiperazine-2,5-dione.
| Compound Name | 3-[[2-(1,3-benzodioxol-5-ylmethyl)-1H-indol-3-yl]methyl]-1-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 23590409 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 3-[[2-(1,3-benzodioxol-5-ylmethyl)-1H-indol-3-yl]methyl]-1-methylpiperazine-2,5-dione |
| SMILES | CN1CC(=O)NC(Cc2c(Cc3ccc4c(c3)OCO4)[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C22H21N3O4/c1-25-11-21(26)24-18(22(25)27)10-15-14-4-2-3-5-16(14)23-17(15)8-13-6-7-19-20(9-13)29-12-28-19/h2-7,9,18,23H,8,10-12H2,1H3,(H,24,26) |
| InChIKey | HFTACSBWNUZQPM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|