C23H23N3O4 — CID 163717279
(3R)-3-[[2-(1,3-benzodioxol-5-ylmethyl)-1H-indol-3-yl]methyl]-1,4-dimethylpiperazine-2,5-dione (PubChem CID 163717279) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is (3R)-3-[[2-(1,3-benzodioxol-5-ylmethyl)-1H-indol-3-yl]methyl]-1,4-dimethylpiperazine-2,5-dione.
| Compound Name | (3R)-3-[[2-(1,3-benzodioxol-5-ylmethyl)-1H-indol-3-yl]methyl]-1,4-dimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 163717279 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | (3R)-3-[[2-(1,3-benzodioxol-5-ylmethyl)-1H-indol-3-yl]methyl]-1,4-dimethylpiperazine-2,5-dione |
| SMILES | CN1CC(=O)N(C)[C@H](Cc2c(Cc3ccc4c(c3)OCO4)[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C23H23N3O4/c1-25-12-22(27)26(2)19(23(25)28)11-16-15-5-3-4-6-17(15)24-18(16)9-14-7-8-20-21(10-14)30-13-29-20/h3-8,10,19,24H,9,11-13H2,1-2H3/t19-/m1/s1 |
| InChIKey | KOLOWYKJKRXKHX-LJQANCHMSA-N |
| XLogP | 2.33 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|