About methyl 5-(2,4-dibromo-5-tert-butylphenoxy)furan-2-carboxylate
methyl 5-(2,4-dibromo-5-tert-butylphenoxy)furan-2-carboxylate (PubChem CID 142192083) has the molecular formula C16H16Br2O4
and a molecular weight of 432.11 g/mol. Its IUPAC name is methyl 5-(2,4-dibromo-5-tert-butylphenoxy)furan-2-carboxylate.
Analyze methyl 5-(2,4-dibromo-5-tert-butylphenoxy)furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(2,4-dibromo-5-tert-butylphenoxy)furan-2-carboxylate?
The IUPAC name of methyl 5-(2,4-dibromo-5-tert-butylphenoxy)furan-2-carboxylate (CID 142192083) is methyl 5-(2,4-dibromo-5-tert-butylphenoxy)furan-2-carboxylate.
What is the SMILES notation for methyl 5-(2,4-dibromo-5-tert-butylphenoxy)furan-2-carboxylate?
The canonical SMILES for methyl 5-(2,4-dibromo-5-tert-butylphenoxy)furan-2-carboxylate is COC(=O)c1ccc(Oc2cc(C(C)(C)C)c(Br)cc2Br)o1.
What is the InChIKey of methyl 5-(2,4-dibromo-5-tert-butylphenoxy)furan-2-carboxylate?
The InChIKey is MBYUYJBDHXFRDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16Br2O4/c1-16(2,3)9-7-13(11(18)8-10(9)17)22-14-6-5-12(21-14)15(19)20-4/h5-8H,1-4H3.
What are the key properties of methyl 5-(2,4-dibromo-5-tert-butylphenoxy)furan-2-carboxylate?
methyl 5-(2,4-dibromo-5-tert-butylphenoxy)furan-2-carboxylate has a molecular weight of 432.11 g/mol, XLogP of 5.68, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(2,4-dibromo-5-tert-butylphenoxy)furan-2-carboxylate is sourced from PubChem (CID 142192083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).