C16H20O4S — CID 143243304
methyl 5-[2-methyl-5-(trimethyl-λ4-sulfanyl)phenoxy]furan-2-carboxylate (PubChem CID 143243304) has the molecular formula C16H20O4S and a molecular weight of 308.40 g/mol. Its IUPAC name is methyl 5-[2-methyl-5-(trimethyl-λ4-sulfanyl)phenoxy]furan-2-carboxylate.
| Compound Name | methyl 5-[2-methyl-5-(trimethyl-λ4-sulfanyl)phenoxy]furan-2-carboxylate |
|---|---|
| PubChem CID | 143243304 |
| Molecular Formula | C16H20O4S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | methyl 5-[2-methyl-5-(trimethyl-λ4-sulfanyl)phenoxy]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(Oc2cc(S(C)(C)C)ccc2C)o1 |
| InChI | InChI=1S/C16H20O4S/c1-11-6-7-12(21(3,4)5)10-14(11)20-15-9-8-13(19-15)16(17)18-2/h6-10H,1-5H3 |
| InChIKey | CIWJXUBRCYOKLZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |