C24H32N2O4S — CID 142195429
3-N-[1-[(1Z,3Z,7Z)-cycloocta-1,3,7-trien-1-yl]-3,4-dihydroxy-6-methylsulfanylhexan-2-yl]-5-methylbenzene-1,3-dicarboxamide (PubChem CID 142195429) has the molecular formula C24H32N2O4S and a molecular weight of 444.60 g/mol. Its IUPAC name is 3-N-[1-[(1Z,3Z,7Z)-cycloocta-1,3,7-trien-1-yl]-3,4-dihydroxy-6-methylsulfanylhexan-2-yl]-5-methylbenzene-1,3-dicarboxamide.
| Compound Name | 3-N-[1-[(1Z,3Z,7Z)-cycloocta-1,3,7-trien-1-yl]-3,4-dihydroxy-6-methylsulfanylhexan-2-yl]-5-methylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 142195429 |
| Molecular Formula | C24H32N2O4S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 3-N-[1-[(1Z,3Z,7Z)-cycloocta-1,3,7-trien-1-yl]-3,4-dihydroxy-6-methylsulfanylhexan-2-yl]-5-methylbenzene-1,3-dicarboxamide |
| SMILES | CSCCC(O)C(O)C(CC1=C/C=C\CC/C=C\1)NC(=O)c1cc(C)cc(C(N)=O)c1 |
| InChI | InChI=1S/C24H32N2O4S/c1-16-12-18(23(25)29)15-19(13-16)24(30)26-20(22(28)21(27)10-11-31-2)14-17-8-6-4-3-5-7-9-17/h4,6-9,12-13,15,20-22,27-28H,3,5,10-11,14H2,1-2H3,(H2,25,29)(H,26,30)/b6-4-,9-7-,17-8+ |
| InChIKey | XXZJUTYCFLOCOC-XLUYVJJZSA-N |
| XLogP | 2.89 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |