C23H29N4O4+ — CID 142196030
(1-amino-2-hydroxybutylidene)-[(2S)-1-(4-cyclohexa-2,4-dien-1-ylbenzoyl)-4-methoxyiminopyrrolidine-2-carbonyl]azanium (PubChem CID 142196030) has the molecular formula C23H29N4O4+ and a molecular weight of 425.51 g/mol. Its IUPAC name is (1-amino-2-hydroxybutylidene)-[(2S)-1-(4-cyclohexa-2,4-dien-1-ylbenzoyl)-4-methoxyiminopyrrolidine-2-carbonyl]azanium.
| Compound Name | (1-amino-2-hydroxybutylidene)-[(2S)-1-(4-cyclohexa-2,4-dien-1-ylbenzoyl)-4-methoxyiminopyrrolidine-2-carbonyl]azanium |
|---|---|
| PubChem CID | 142196030 |
| Molecular Formula | C23H29N4O4+ |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | (1-amino-2-hydroxybutylidene)-[(2S)-1-(4-cyclohexa-2,4-dien-1-ylbenzoyl)-4-methoxyiminopyrrolidine-2-carbonyl]azanium |
| SMILES | CCC(O)/C(N)=[NH+]/C(=O)[C@@H]1CC(=NOC)CN1C(=O)c1ccc(C2C=CC=CC2)cc1 |
| InChI | InChI=1S/C23H28N4O4/c1-3-20(28)21(24)25-22(29)19-13-18(26-31-2)14-27(19)23(30)17-11-9-16(10-12-17)15-7-5-4-6-8-15/h4-7,9-12,15,19-20,28H,3,8,13-14H2,1-2H3,(H2,24,25,29)/p+1/t15?,19-,20?/m0/s1 |
| InChIKey | NBCKDANOMPTHEM-YHDJDMAPSA-O |
| XLogP | 0.24 |
| TPSA | 119.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|