C16H21NO — CID 142196450
(3E,5Z)-N-[(5-methoxy-2-methylphenyl)methyl]hepta-1,3,5-trien-3-amine (PubChem CID 142196450) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is (3E,5Z)-N-[(5-methoxy-2-methylphenyl)methyl]hepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5Z)-N-[(5-methoxy-2-methylphenyl)methyl]hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 142196450 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (3E,5Z)-N-[(5-methoxy-2-methylphenyl)methyl]hepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(=C\C=C/C)NCc1cc(OC)ccc1C |
| InChI | InChI=1S/C16H21NO/c1-5-7-8-15(6-2)17-12-14-11-16(18-4)10-9-13(14)3/h5-11,17H,2,12H2,1,3-4H3/b7-5-,15-8+ |
| InChIKey | XKFNKLKSUPYBGR-VEQUYXNOSA-N |
| XLogP | 3.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|