C28H33N5O3 — CID 142197057
6-(2,3-dihydro-1H-inden-5-ylamino)-3-[5-oxo-5-(4-phenylpiperazin-1-yl)pentyl]-1H-pyrimidine-2,4-dione (PubChem CID 142197057) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is 6-(2,3-dihydro-1H-inden-5-ylamino)-3-[5-oxo-5-(4-phenylpiperazin-1-yl)pentyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(2,3-dihydro-1H-inden-5-ylamino)-3-[5-oxo-5-(4-phenylpiperazin-1-yl)pentyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142197057 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 6-(2,3-dihydro-1H-inden-5-ylamino)-3-[5-oxo-5-(4-phenylpiperazin-1-yl)pentyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=C(CCCCn1c(=O)cc(Nc2ccc3c(c2)CCC3)[nH]c1=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C28H33N5O3/c34-26(32-17-15-31(16-18-32)24-9-2-1-3-10-24)11-4-5-14-33-27(35)20-25(30-28(33)36)29-23-13-12-21-7-6-8-22(21)19-23/h1-3,9-10,12-13,19-20,29H,4-8,11,14-18H2,(H,30,36) |
| InChIKey | XLKHCGYXCRBIQX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 90.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|