C22H21NO — CID 142200146
3-[2-[6-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3-pyridinyl]prop-2-enyl]benzaldehyde (PubChem CID 142200146) has the molecular formula C22H21NO and a molecular weight of 315.42 g/mol. Its IUPAC name is 3-[2-[6-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3-pyridinyl]prop-2-enyl]benzaldehyde.
| Compound Name | 3-[2-[6-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3-pyridinyl]prop-2-enyl]benzaldehyde |
|---|---|
| PubChem CID | 142200146 |
| Molecular Formula | C22H21NO |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 3-[2-[6-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3-pyridinyl]prop-2-enyl]benzaldehyde |
| SMILES | C=C(Cc1cccc(C=O)c1)c1ccc(C(=C)/C=C\C=C/C)nc1 |
| InChI | InChI=1S/C22H21NO/c1-4-5-6-8-17(2)22-12-11-21(15-23-22)18(3)13-19-9-7-10-20(14-19)16-24/h4-12,14-16H,2-3,13H2,1H3/b5-4-,8-6- |
| InChIKey | VIMSOEVLLRIVNO-NADLECRISA-N |
| XLogP | 5.30 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|