C27H37N3O2 — CID 142203854
1-[3-[1-[3-(7-methoxy-1H-indol-3-yl)propyl]piperidin-4-yl]anilino]-2-methylpropan-1-ol (PubChem CID 142203854) has the molecular formula C27H37N3O2 and a molecular weight of 435.61 g/mol. Its IUPAC name is 1-[3-[1-[3-(7-methoxy-1H-indol-3-yl)propyl]piperidin-4-yl]anilino]-2-methylpropan-1-ol.
| Compound Name | 1-[3-[1-[3-(7-methoxy-1H-indol-3-yl)propyl]piperidin-4-yl]anilino]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 142203854 |
| Molecular Formula | C27H37N3O2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | 1-[3-[1-[3-(7-methoxy-1H-indol-3-yl)propyl]piperidin-4-yl]anilino]-2-methylpropan-1-ol |
| SMILES | COc1cccc2c(CCCN3CCC(c4cccc(NC(O)C(C)C)c4)CC3)c[nH]c12 |
| InChI | InChI=1S/C27H37N3O2/c1-19(2)27(31)29-23-9-4-7-21(17-23)20-12-15-30(16-13-20)14-6-8-22-18-28-26-24(22)10-5-11-25(26)32-3/h4-5,7,9-11,17-20,27-29,31H,6,8,12-16H2,1-3H3 |
| InChIKey | WTYBFHMWFUIFEM-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 60.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|