C31H40N2O3 — CID 20722980
1-[3-[1-[3-(4-methoxyphenoxy)-3-phenylpropyl]piperidin-4-yl]anilino]-2-methylpropan-1-ol (PubChem CID 20722980) has the molecular formula C31H40N2O3 and a molecular weight of 488.67 g/mol. Its IUPAC name is 1-[3-[1-[3-(4-methoxyphenoxy)-3-phenylpropyl]piperidin-4-yl]anilino]-2-methylpropan-1-ol.
| Compound Name | 1-[3-[1-[3-(4-methoxyphenoxy)-3-phenylpropyl]piperidin-4-yl]anilino]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 20722980 |
| Molecular Formula | C31H40N2O3 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | 1-[3-[1-[3-(4-methoxyphenoxy)-3-phenylpropyl]piperidin-4-yl]anilino]-2-methylpropan-1-ol |
| SMILES | COc1ccc(OC(CCN2CCC(c3cccc(NC(O)C(C)C)c3)CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H40N2O3/c1-23(2)31(34)32-27-11-7-10-26(22-27)24-16-19-33(20-17-24)21-18-30(25-8-5-4-6-9-25)36-29-14-12-28(35-3)13-15-29/h4-15,22-24,30-32,34H,16-21H2,1-3H3 |
| InChIKey | UQSDVBQDGOXCLM-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|