C9H10O2S — CID 142204948
2,3,4,5-tetrahydro-1-benzothiophene-2-carboxylic acid (PubChem CID 142204948) has the molecular formula C9H10O2S and a molecular weight of 182.24 g/mol. Its IUPAC name is 2,3,4,5-tetrahydro-1-benzothiophene-2-carboxylic acid.
| Compound Name | 2,3,4,5-tetrahydro-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 142204948 |
| Molecular Formula | C9H10O2S |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 2,3,4,5-tetrahydro-1-benzothiophene-2-carboxylic acid |
| SMILES | O=C(O)C1CC2=C(C=CCC2)S1 |
| InChI | InChI=1S/C9H10O2S/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h2,4,8H,1,3,5H2,(H,10,11) |
| InChIKey | PZUGXMNMFVWHGN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |