C10H13N3O3S — CID 135474986
2-(cyclopenten-1-ylhydrazinylidene)-4-oxo-1,3-thiazinane-6-carboxylic acid (PubChem CID 135474986) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is 2-(cyclopenten-1-ylhydrazinylidene)-4-oxo-1,3-thiazinane-6-carboxylic acid.
| Compound Name | 2-(cyclopenten-1-ylhydrazinylidene)-4-oxo-1,3-thiazinane-6-carboxylic acid |
|---|---|
| PubChem CID | 135474986 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 2-(cyclopenten-1-ylhydrazinylidene)-4-oxo-1,3-thiazinane-6-carboxylic acid |
| SMILES | O=C1CC(C(=O)O)SC(=NNC2=CCCC2)N1 |
| InChI | InChI=1S/C10H13N3O3S/c14-8-5-7(9(15)16)17-10(11-8)13-12-6-3-1-2-4-6/h3,7,12H,1-2,4-5H2,(H,15,16)(H,11,13,14) |
| InChIKey | IIBVVMCJQVFOPV-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|