C13H12N3O3S- — CID 135706527
(2E)-4-oxo-2-(1-phenylethenylhydrazinylidene)-1,3-thiazinane-6-carboxylate (PubChem CID 135706527) has the molecular formula C13H12N3O3S- and a molecular weight of 290.32 g/mol. Its IUPAC name is (2E)-4-oxo-2-(1-phenylethenylhydrazinylidene)-1,3-thiazinane-6-carboxylate.
| Compound Name | (2E)-4-oxo-2-(1-phenylethenylhydrazinylidene)-1,3-thiazinane-6-carboxylate |
|---|---|
| PubChem CID | 135706527 |
| Molecular Formula | C13H12N3O3S- |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | (2E)-4-oxo-2-(1-phenylethenylhydrazinylidene)-1,3-thiazinane-6-carboxylate |
| SMILES | C=C(N/N=C1\NC(=O)CC(C(=O)[O-])S1)c1ccccc1 |
| InChI | InChI=1S/C13H13N3O3S/c1-8(9-5-3-2-4-6-9)15-16-13-14-11(17)7-10(20-13)12(18)19/h2-6,10,15H,1,7H2,(H,18,19)(H,14,16,17)/p-1 |
| InChIKey | UNTUCARTDDEPKA-UHFFFAOYSA-M |
| XLogP | -0.11 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|