C10H12N3O3S- — CID 135506764
2-[2-(cyclopenten-1-ylhydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetate (PubChem CID 135506764) has the molecular formula C10H12N3O3S- and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-[2-(cyclopenten-1-ylhydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetate.
| Compound Name | 2-[2-(cyclopenten-1-ylhydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 135506764 |
| Molecular Formula | C10H12N3O3S- |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 2-[2-(cyclopenten-1-ylhydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetate |
| SMILES | O=C([O-])CC1SC(=NNC2=CCCC2)NC1=O |
| InChI | InChI=1S/C10H13N3O3S/c14-8(15)5-7-9(16)11-10(17-7)13-12-6-3-1-2-4-6/h3,7,12H,1-2,4-5H2,(H,14,15)(H,11,13,16)/p-1 |
| InChIKey | BCEOOQVKMBEBMQ-UHFFFAOYSA-M |
| XLogP | -0.71 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|