C20H20N2O2 — CID 142205996
[(Z)-2-(3-methyl-1,2-dihydrobenzimidazol-2-yl)-1-phenylethenyl] (E)-but-2-enoate (PubChem CID 142205996) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is [(Z)-2-(3-methyl-1,2-dihydrobenzimidazol-2-yl)-1-phenylethenyl] (E)-but-2-enoate.
| Compound Name | [(Z)-2-(3-methyl-1,2-dihydrobenzimidazol-2-yl)-1-phenylethenyl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 142205996 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | [(Z)-2-(3-methyl-1,2-dihydrobenzimidazol-2-yl)-1-phenylethenyl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)O/C(=C\C1Nc2ccccc2N1C)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O2/c1-3-9-20(23)24-18(15-10-5-4-6-11-15)14-19-21-16-12-7-8-13-17(16)22(19)2/h3-14,19,21H,1-2H3/b9-3+,18-14- |
| InChIKey | AYPDZFCJXKQLLF-LVIXSLOYSA-N |
| XLogP | 4.03 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|