About N-ethenylmethanimine;(E)-1-methoxy-2-methylbut-2-ene;toluene
N-ethenylmethanimine;(E)-1-methoxy-2-methylbut-2-ene;toluene (PubChem CID 142206770) has the molecular formula C16H25NO
and a molecular weight of 247.38 g/mol. Its IUPAC name is N-ethenylmethanimine;(E)-1-methoxy-2-methylbut-2-ene;toluene.
Molecular Properties
| Compound Name | N-ethenylmethanimine;(E)-1-methoxy-2-methylbut-2-ene;toluene |
| PubChem CID | 142206770 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | N-ethenylmethanimine;(E)-1-methoxy-2-methylbut-2-ene;toluene |
| SMILES | C/C=C(\C)COC.C=CN=C.Cc1ccccc1 |
| InChI | InChI=1S/C7H8.C6H12O.C3H5N/c1-7-5-3-2-4-6-7;1-4-6(2)5-7-3;1-3-4-2/h2-6H,1H3;4H,5H2,1-3H3;3H,1-2H2/b;6-4+; |
| InChIKey | YUDLHHUYLXUKLN-HWWUXOKASA-N |
| XLogP | 4.42 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethenylmethanimine;(E)-1-methoxy-2-methylbut-2-ene;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenylmethanimine;(E)-1-methoxy-2-methylbut-2-ene;toluene?
The IUPAC name of N-ethenylmethanimine;(E)-1-methoxy-2-methylbut-2-ene;toluene (CID 142206770) is N-ethenylmethanimine;(E)-1-methoxy-2-methylbut-2-ene;toluene.
What is the SMILES notation for N-ethenylmethanimine;(E)-1-methoxy-2-methylbut-2-ene;toluene?
The canonical SMILES for N-ethenylmethanimine;(E)-1-methoxy-2-methylbut-2-ene;toluene is C/C=C(\C)COC.C=CN=C.Cc1ccccc1.
What is the InChIKey of N-ethenylmethanimine;(E)-1-methoxy-2-methylbut-2-ene;toluene?
The InChIKey is YUDLHHUYLXUKLN-HWWUXOKASA-N. The full InChI is InChI=1S/C7H8.C6H12O.C3H5N/c1-7-5-3-2-4-6-7;1-4-6(2)5-7-3;1-3-4-2/h2-6H,1H3;4H,5H2,1-3H3;3H,1-2H2/b;6-4+;.
What are the key properties of N-ethenylmethanimine;(E)-1-methoxy-2-methylbut-2-ene;toluene?
N-ethenylmethanimine;(E)-1-methoxy-2-methylbut-2-ene;toluene has a molecular weight of 247.38 g/mol, XLogP of 4.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenylmethanimine;(E)-1-methoxy-2-methylbut-2-ene;toluene is sourced from PubChem (CID 142206770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).