C23H29ClN4O4S — CID 142209577
5-chloro-N-[2-formyl-3-[methyl-(3-oxo-3-piperazin-1-ylpropyl)carbamoyl]phenyl]thiophene-2-carboxamide;ethane (PubChem CID 142209577) has the molecular formula C23H29ClN4O4S and a molecular weight of 493.03 g/mol. Its IUPAC name is 5-chloro-N-[2-formyl-3-[methyl-(3-oxo-3-piperazin-1-ylpropyl)carbamoyl]phenyl]thiophene-2-carboxamide;ethane.
| Compound Name | 5-chloro-N-[2-formyl-3-[methyl-(3-oxo-3-piperazin-1-ylpropyl)carbamoyl]phenyl]thiophene-2-carboxamide;ethane |
|---|---|
| PubChem CID | 142209577 |
| Molecular Formula | C23H29ClN4O4S |
| Molecular Weight | 493.03 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 5-chloro-N-[2-formyl-3-[methyl-(3-oxo-3-piperazin-1-ylpropyl)carbamoyl]phenyl]thiophene-2-carboxamide;ethane |
| SMILES | CC.CN(CCC(=O)N1CCNCC1)C(=O)c1cccc(NC(=O)c2ccc(Cl)s2)c1C=O |
| InChI | InChI=1S/C21H23ClN4O4S.C2H6/c1-25(10-7-19(28)26-11-8-23-9-12-26)21(30)14-3-2-4-16(15(14)13-27)24-20(29)17-5-6-18(22)31-17;1-2/h2-6,13,23H,7-12H2,1H3,(H,24,29);1-2H3 |
| InChIKey | WDGVKOIHALEOHV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.03 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|