C22H20OS — CID 142211177
2-(7-methylcyclohepta-1,3,6-trien-1-yl)-1-(5-methyl-4-phenylthiophen-2-yl)prop-2-en-1-one (PubChem CID 142211177) has the molecular formula C22H20OS and a molecular weight of 332.47 g/mol. Its IUPAC name is 2-(7-methylcyclohepta-1,3,6-trien-1-yl)-1-(5-methyl-4-phenylthiophen-2-yl)prop-2-en-1-one.
| Compound Name | 2-(7-methylcyclohepta-1,3,6-trien-1-yl)-1-(5-methyl-4-phenylthiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 142211177 |
| Molecular Formula | C22H20OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-(7-methylcyclohepta-1,3,6-trien-1-yl)-1-(5-methyl-4-phenylthiophen-2-yl)prop-2-en-1-one |
| SMILES | C=C(C(=O)c1cc(-c2ccccc2)c(C)s1)C1=CC=CCC=C1C |
| InChI | InChI=1S/C22H20OS/c1-15-10-6-4-9-13-19(15)16(2)22(23)21-14-20(17(3)24-21)18-11-7-5-8-12-18/h4-5,7-14H,2,6H2,1,3H3 |
| InChIKey | WAAAMQZNQLDTQL-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|